C12H22F3NOS — CID 88902638
N-(2,2-dimethylpropyl)-3,3,3-trifluoro-2-(propylsulfanylmethyl)propanamide (PubChem CID 88902638) has the molecular formula C12H22F3NOS and a molecular weight of 285.38 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-3,3,3-trifluoro-2-(propylsulfanylmethyl)propanamide.
| Compound Name | N-(2,2-dimethylpropyl)-3,3,3-trifluoro-2-(propylsulfanylmethyl)propanamide |
|---|---|
| PubChem CID | 88902638 |
| Molecular Formula | C12H22F3NOS |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-(2,2-dimethylpropyl)-3,3,3-trifluoro-2-(propylsulfanylmethyl)propanamide |
| SMILES | CCCSCC(C(=O)NCC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H22F3NOS/c1-5-6-18-7-9(12(13,14)15)10(17)16-8-11(2,3)4/h9H,5-8H2,1-4H3,(H,16,17) |
| InChIKey | ZFAJTERRLUTVPI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|