C8H10O4 — CID 88902926
5-hydroxy-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione (PubChem CID 88902926) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 5-hydroxy-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione.
| Compound Name | 5-hydroxy-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 88902926 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 5-hydroxy-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2CC(O)CCC12 |
| InChI | InChI=1S/C8H10O4/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h4-6,9H,1-3H2 |
| InChIKey | LLQHSLAFOLEYIN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|