About 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine
1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine (PubChem CID 88902973) has the molecular formula C12H12BN3O3
and a molecular weight of 257.06 g/mol. Its IUPAC name is 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine.
Molecular Properties
| Compound Name | 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine |
| PubChem CID | 88902973 |
| Molecular Formula | C12H12BN3O3 |
| Molecular Weight | 257.06 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine |
| SMILES | OB1OCCc2ccc(NOc3ccnnc3)cc21 |
| InChI | InChI=1S/C12H12BN3O3/c17-13-12-7-10(2-1-9(12)4-6-18-13)16-19-11-3-5-14-15-8-11/h1-3,5,7-8,16-17H,4,6H2 |
| InChIKey | PAVGSELSAXVPNX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.06 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine?
The IUPAC name of 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine (CID 88902973) is 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine.
What is the SMILES notation for 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine?
The canonical SMILES for 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine is OB1OCCc2ccc(NOc3ccnnc3)cc21.
What is the InChIKey of 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine?
The InChIKey is PAVGSELSAXVPNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BN3O3/c17-13-12-7-10(2-1-9(12)4-6-18-13)16-19-11-3-5-14-15-8-11/h1-3,5,7-8,16-17H,4,6H2.
What are the key properties of 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine?
1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine has a molecular weight of 257.06 g/mol, XLogP of 0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-N-pyridazin-4-yloxy-3,4-dihydro-2,1-benzoxaborinin-7-amine is sourced from PubChem (CID 88902973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).