C7H6F5NO3 — CID 88903143
2,2,3,3,3-pentafluoro-N-(2-oxooxolan-3-yl)propanamide (PubChem CID 88903143) has the molecular formula C7H6F5NO3 and a molecular weight of 247.12 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(2-oxooxolan-3-yl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(2-oxooxolan-3-yl)propanamide |
|---|---|
| PubChem CID | 88903143 |
| Molecular Formula | C7H6F5NO3 |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(2-oxooxolan-3-yl)propanamide |
| SMILES | O=C1OCCC1NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F5NO3/c8-6(9,7(10,11)12)5(15)13-3-1-2-16-4(3)14/h3H,1-2H2,(H,13,15) |
| InChIKey | RNSQINXUQVPRPY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|