C14H22F3N3 — CID 88903206
2-[4-[(3E,5Z)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl]piperazin-1-yl]ethanamine (PubChem CID 88903206) has the molecular formula C14H22F3N3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[4-[(3E,5Z)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl]piperazin-1-yl]ethanamine.
| Compound Name | 2-[4-[(3E,5Z)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl]piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 88903206 |
| Molecular Formula | C14H22F3N3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-[4-[(3E,5Z)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl]piperazin-1-yl]ethanamine |
| SMILES | C=C(/C=C(\C=C/C)C(F)(F)F)N1CCN(CCN)CC1 |
| InChI | InChI=1S/C14H22F3N3/c1-3-4-13(14(15,16)17)11-12(2)20-9-7-19(6-5-18)8-10-20/h3-4,11H,2,5-10,18H2,1H3/b4-3-,13-11+ |
| InChIKey | RKVVROIVYRNWIC-KBCNIFDOSA-N |
| XLogP | 2.14 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|