C15H21F3O5S — CID 88903302
1,1,2-trifluoro-3-(tricyclo[5.3.1.03,9]undecane-1-carbonyloxy)propane-1-sulfonic acid (PubChem CID 88903302) has the molecular formula C15H21F3O5S and a molecular weight of 370.39 g/mol. Its IUPAC name is 1,1,2-trifluoro-3-(tricyclo[5.3.1.03,9]undecane-1-carbonyloxy)propane-1-sulfonic acid.
| Compound Name | 1,1,2-trifluoro-3-(tricyclo[5.3.1.03,9]undecane-1-carbonyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88903302 |
| Molecular Formula | C15H21F3O5S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1,1,2-trifluoro-3-(tricyclo[5.3.1.03,9]undecane-1-carbonyloxy)propane-1-sulfonic acid |
| SMILES | O=C(OCC(F)C(F)(F)S(=O)(=O)O)C12CC3CCCC(C1)C(C3)C2 |
| InChI | InChI=1S/C15H21F3O5S/c16-12(15(17,18)24(20,21)22)8-23-13(19)14-5-9-2-1-3-10(6-14)11(4-9)7-14/h9-12H,1-8H2,(H,20,21,22) |
| InChIKey | FBSJBPAMBLPWAJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|