About 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde
1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde (PubChem CID 88903316) has the molecular formula C25H21FN2O2
and a molecular weight of 400.45 g/mol. Its IUPAC name is 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde |
| PubChem CID | 88903316 |
| Molecular Formula | C25H21FN2O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde |
| SMILES | O=CC1CN(Cc2ccc(-c3cc4cc(Cc5ccccc5)ncc4o3)c(F)c2)C1 |
| InChI | InChI=1S/C25H21FN2O2/c26-23-9-18(13-28-14-19(15-28)16-29)6-7-22(23)24-11-20-10-21(27-12-25(20)30-24)8-17-4-2-1-3-5-17/h1-7,9-12,16,19H,8,13-15H2 |
| InChIKey | LDPXBKQYWHDWCO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde?
The IUPAC name of 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde (CID 88903316) is 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde.
What is the SMILES notation for 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde?
The canonical SMILES for 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde is O=CC1CN(Cc2ccc(-c3cc4cc(Cc5ccccc5)ncc4o3)c(F)c2)C1.
What is the InChIKey of 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde?
The InChIKey is LDPXBKQYWHDWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21FN2O2/c26-23-9-18(13-28-14-19(15-28)16-29)6-7-22(23)24-11-20-10-21(27-12-25(20)30-24)8-17-4-2-1-3-5-17/h1-7,9-12,16,19H,8,13-15H2.
What are the key properties of 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde?
1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde has a molecular weight of 400.45 g/mol, XLogP of 4.86, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(5-benzylfuro[2,3-c]pyridin-2-yl)-3-fluorophenyl]methyl]azetidine-3-carbaldehyde is sourced from PubChem (CID 88903316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).