About methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate
methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate (PubChem CID 88903339) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate |
| PubChem CID | 88903339 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate |
| SMILES | C/N=C(\C)c1ccc(C(=O)OC)s1 |
| InChI | InChI=1S/C9H11NO2S/c1-6(10-2)7-4-5-8(13-7)9(11)12-3/h4-5H,1-3H3/b10-6+ |
| InChIKey | YLBQVMDLAJPANW-UXBLZVDNSA-N |
| XLogP | 1.97 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate?
The IUPAC name of methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate (CID 88903339) is methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate?
The canonical SMILES for methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate is C/N=C(\C)c1ccc(C(=O)OC)s1.
What is the InChIKey of methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate?
The InChIKey is YLBQVMDLAJPANW-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H11NO2S/c1-6(10-2)7-4-5-8(13-7)9(11)12-3/h4-5H,1-3H3/b10-6+.
What are the key properties of methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate?
methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate has a molecular weight of 197.26 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(C,N-dimethylcarbonimidoyl)thiophene-2-carboxylate is sourced from PubChem (CID 88903339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).