C13H15F3O7S — CID 88903461
1,1,2-trifluoro-3-(5-oxo-4-oxatricyclo[4.3.1.03,10]decane-7-carbonyl)oxypropane-1-sulfonic acid (PubChem CID 88903461) has the molecular formula C13H15F3O7S and a molecular weight of 372.32 g/mol. Its IUPAC name is 1,1,2-trifluoro-3-(5-oxo-4-oxatricyclo[4.3.1.03,10]decane-7-carbonyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1,2-trifluoro-3-(5-oxo-4-oxatricyclo[4.3.1.03,10]decane-7-carbonyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88903461 |
| Molecular Formula | C13H15F3O7S |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 1,1,2-trifluoro-3-(5-oxo-4-oxatricyclo[4.3.1.03,10]decane-7-carbonyl)oxypropane-1-sulfonic acid |
| SMILES | O=C(OCC(F)C(F)(F)S(=O)(=O)O)C1CCC2CC3OC(=O)C1C23 |
| InChI | InChI=1S/C13H15F3O7S/c14-8(13(15,16)24(19,20)21)4-22-11(17)6-2-1-5-3-7-9(5)10(6)12(18)23-7/h5-10H,1-4H2,(H,19,20,21) |
| InChIKey | DPHNIJYWRZGRBW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|