C13H20O3 — CID 88903670
2-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-(oxiran-2-ylmethyl)-1,3-dioxolane (PubChem CID 88903670) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-(oxiran-2-ylmethyl)-1,3-dioxolane.
| Compound Name | 2-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-(oxiran-2-ylmethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 88903670 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-(oxiran-2-ylmethyl)-1,3-dioxolane |
| SMILES | C/C=C\C(=C/CC)C1(CC2CO2)OCCO1 |
| InChI | InChI=1S/C13H20O3/c1-3-5-11(6-4-2)13(9-12-10-14-12)15-7-8-16-13/h3,5-6,12H,4,7-10H2,1-2H3/b5-3-,11-6+ |
| InChIKey | DXBSALUVICBBHT-GGKXIICKSA-N |
| XLogP | 2.43 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|