About 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate
3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate (PubChem CID 88903776) has the molecular formula C26H42O9
and a molecular weight of 498.61 g/mol. Its IUPAC name is 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate.
Molecular Properties
| Compound Name | 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate |
| PubChem CID | 88903776 |
| Molecular Formula | C26H42O9 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)COCCCOCC(CC)(COCCCOCC(=O)C=C)COCCCOC(=O)C=C |
| InChI | InChI=1S/C26H42O9/c1-5-23(27)18-30-12-9-14-32-20-26(8-4,22-34-16-11-17-35-25(29)7-3)21-33-15-10-13-31-19-24(28)6-2/h5-7H,1-3,8-22H2,4H3 |
| InChIKey | PKYDUDBQPFNZGH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate?
The IUPAC name of 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate (CID 88903776) is 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate.
What is the SMILES notation for 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate?
The canonical SMILES for 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate is C=CC(=O)COCCCOCC(CC)(COCCCOCC(=O)C=C)COCCCOC(=O)C=C.
What is the InChIKey of 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate?
The InChIKey is PKYDUDBQPFNZGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H42O9/c1-5-23(27)18-30-12-9-14-32-20-26(8-4,22-34-16-11-17-35-25(29)7-3)21-33-15-10-13-31-19-24(28)6-2/h5-7H,1-3,8-22H2,4H3.
What are the key properties of 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate?
3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate has a molecular weight of 498.61 g/mol, XLogP of 2.88, 26 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-bis[3-(2-oxobut-3-enoxy)propoxymethyl]butoxy]propyl prop-2-enoate is sourced from PubChem (CID 88903776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).