C12H13N — CID 88903924
5,6,9,9a-tetrahydro-1H-carbazole (PubChem CID 88903924) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 5,6,9,9a-tetrahydro-1H-carbazole.
| Compound Name | 5,6,9,9a-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 88903924 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 5,6,9,9a-tetrahydro-1H-carbazole |
| SMILES | C1=CCC2NC3=C(CCC=C3)C2=C1 |
| InChI | InChI=1S/C12H13N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1,3-5,8,11,13H,2,6-7H2 |
| InChIKey | VQYCQBPAZXSMDT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |