C8H11I — CID 88904584
(2Z,4Z,6Z)-3-iodoocta-2,4,6-triene (PubChem CID 88904584) has the molecular formula C8H11I and a molecular weight of 234.08 g/mol. Its IUPAC name is (2Z,4Z,6Z)-3-iodoocta-2,4,6-triene.
| Compound Name | (2Z,4Z,6Z)-3-iodoocta-2,4,6-triene |
|---|---|
| PubChem CID | 88904584 |
| Molecular Formula | C8H11I |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | (2Z,4Z,6Z)-3-iodoocta-2,4,6-triene |
| SMILES | C/C=C\C=C/C(I)=C/C |
| InChI | InChI=1S/C8H11I/c1-3-5-6-7-8(9)4-2/h3-7H,1-2H3/b5-3-,7-6-,8-4- |
| InChIKey | WLPHOFSXYOCXSD-ALFUGJGVSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|