C20H21FN4O2 — CID 88904637
1-[2-[2-(2-fluoroethoxy)ethoxy]ethyl]-5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrrolo[2,3-b]pyridine (PubChem CID 88904637) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is 1-[2-[2-(2-fluoroethoxy)ethoxy]ethyl]-5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-[2-[2-(2-fluoroethoxy)ethoxy]ethyl]-5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 88904637 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[2-[2-(2-fluoroethoxy)ethoxy]ethyl]-5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrrolo[2,3-b]pyridine |
| SMILES | FCCOCCOCCn1ccc2cc(-c3cnc4[nH]ccc4c3)cnc21 |
| InChI | InChI=1S/C20H21FN4O2/c21-3-7-26-9-10-27-8-6-25-5-2-16-12-18(14-24-20(16)25)17-11-15-1-4-22-19(15)23-13-17/h1-2,4-5,11-14H,3,6-10H2,(H,22,23) |
| InChIKey | MURZEDUVLIHGJT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|