C13H18F6O4 — CID 88904715
[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2,4,4-trimethylpentanoate (PubChem CID 88904715) has the molecular formula C13H18F6O4 and a molecular weight of 352.27 g/mol. Its IUPAC name is [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2,4,4-trimethylpentanoate.
| Compound Name | [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 88904715 |
| Molecular Formula | C13H18F6O4 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2,4,4-trimethylpentanoate |
| SMILES | CC(CC(C)(C)C)C(=O)OCC(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H18F6O4/c1-7(5-11(2,3)4)9(21)22-6-8(20)23-10(12(14,15)16)13(17,18)19/h7,10H,5-6H2,1-4H3 |
| InChIKey | FNAMQROKQOEDHA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |