About CID 88904760
CID 88904760 (PubChem CID 88904760) has the molecular formula C36H36B4ClN9O6S
and a molecular weight of 801.51 g/mol.
Molecular Properties
| Compound Name | CID 88904760 |
| PubChem CID | 88904760 |
| Molecular Formula | C36H36B4ClN9O6S |
| Molecular Weight | 801.51 g/mol |
| Exact Mass | 801.26 |
| IUPAC Name | — |
| SMILES | [B]NCCC[C@H](N[B])C(=O)OC[C@@H](COc1ccc(-c2c(C#N)c(N)nc(SCc3coc(-c4ccc(Cl)cc4)n3)c2C#N)cc1)OC(=O)[C@H](CCCN[B])N[B] |
| InChI | InChI=1S/C36H36B4ClN9O6S/c37-45-13-1-3-29(49-39)35(51)55-19-26(56-36(52)30(50-40)4-2-14-46-38)18-53-25-11-7-21(8-12-25)31-27(15-42)32(44)48-34(28(31)16-43)57-20-24-17-54-33(47-24)22-5-9-23(41)10-6-22/h5-12,17,26,29-30,45-46,49-50H,1-4,13-14,18-20H2,(H2,44,48)/t26-,29+,30+/m1/s1 |
| InChIKey | TYXIHCCIIMPBEK-POLDFPFKSA-N |
| XLogP | 2.50 |
| TPSA | 222.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 801.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88904760 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88904760?
The IUPAC name of CID 88904760 (CID 88904760) is not available.
What is the SMILES notation for CID 88904760?
The canonical SMILES for CID 88904760 is [B]NCCC[C@H](N[B])C(=O)OC[C@@H](COc1ccc(-c2c(C#N)c(N)nc(SCc3coc(-c4ccc(Cl)cc4)n3)c2C#N)cc1)OC(=O)[C@H](CCCN[B])N[B].
What is the InChIKey of CID 88904760?
The InChIKey is TYXIHCCIIMPBEK-POLDFPFKSA-N. The full InChI is InChI=1S/C36H36B4ClN9O6S/c37-45-13-1-3-29(49-39)35(51)55-19-26(56-36(52)30(50-40)4-2-14-46-38)18-53-25-11-7-21(8-12-25)31-27(15-42)32(44)48-34(28(31)16-43)57-20-24-17-54-33(47-24)22-5-9-23(41)10-6-22/h5-12,17,26,29-30,45-46,49-50H,1-4,13-14,18-20H2,(H2,44,48)/t26-,29+,30+/m1/s1.
What are the key properties of CID 88904760?
CID 88904760 has a molecular weight of 801.51 g/mol, XLogP of 2.50, 23 rotatable bonds, 5 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88904760 is sourced from PubChem (CID 88904760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).