C34H38O2 — CID 88904860
2-(3-tetracyclo[5.3.1.03,9.05,9]undecanyl)propan-2-yl 4-(anthracen-2-ylmethyl)pent-4-enoate (PubChem CID 88904860) has the molecular formula C34H38O2 and a molecular weight of 478.68 g/mol. Its IUPAC name is 2-(3-tetracyclo[5.3.1.03,9.05,9]undecanyl)propan-2-yl 4-(anthracen-2-ylmethyl)pent-4-enoate.
| Compound Name | 2-(3-tetracyclo[5.3.1.03,9.05,9]undecanyl)propan-2-yl 4-(anthracen-2-ylmethyl)pent-4-enoate |
|---|---|
| PubChem CID | 88904860 |
| Molecular Formula | C34H38O2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 2-(3-tetracyclo[5.3.1.03,9.05,9]undecanyl)propan-2-yl 4-(anthracen-2-ylmethyl)pent-4-enoate |
| SMILES | C=C(CCC(=O)OC(C)(C)C12CC3CC4CC(C1)C2(C4)C3)Cc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C34H38O2/c1-22(12-23-9-10-28-16-26-6-4-5-7-27(26)17-29(28)14-23)8-11-31(35)36-32(2,3)34-20-25-13-24-15-30(21-34)33(34,18-24)19-25/h4-7,9-10,14,16-17,24-25,30H,1,8,11-13,15,18-21H2,2-3H3 |
| InChIKey | FAVXUKNFMGOFDA-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|