About (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate
(1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate (PubChem CID 88904868) has the molecular formula C24H28O2S
and a molecular weight of 380.55 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate |
| PubChem CID | 88904868 |
| Molecular Formula | C24H28O2S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate |
| SMILES | CCC1(OC(=O)CSCc2cccc3cc4c(cc23)=CCCC=4)CCCC1 |
| InChI | InChI=1S/C24H28O2S/c1-2-24(12-5-6-13-24)26-23(25)17-27-16-21-11-7-10-20-14-18-8-3-4-9-19(18)15-22(20)21/h7-11,14-15H,2-6,12-13,16-17H2,1H3 |
| InChIKey | KMIIUUPMDFVTHW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate?
The IUPAC name of (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate (CID 88904868) is (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate.
What is the SMILES notation for (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate?
The canonical SMILES for (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate is CCC1(OC(=O)CSCc2cccc3cc4c(cc23)=CCCC=4)CCCC1.
What is the InChIKey of (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate?
The InChIKey is KMIIUUPMDFVTHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O2S/c1-2-24(12-5-6-13-24)26-23(25)17-27-16-21-11-7-10-20-14-18-8-3-4-9-19(18)15-22(20)21/h7-11,14-15H,2-6,12-13,16-17H2,1H3.
What are the key properties of (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate?
(1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate has a molecular weight of 380.55 g/mol, XLogP of 4.69, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 2-(6,7-dihydroanthracen-1-ylmethylsulfanyl)acetate is sourced from PubChem (CID 88904868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).