C26H24N2O8 — CID 88904908
[3-[3-[(E)-hydroxyiminomethyl]-2,4-dimethoxybenzoyl]phenyl]-[3-[(E)-hydroxyiminomethyl]-2,4-dimethoxyphenyl]methanone (PubChem CID 88904908) has the molecular formula C26H24N2O8 and a molecular weight of 492.48 g/mol. Its IUPAC name is [3-[3-[(E)-hydroxyiminomethyl]-2,4-dimethoxybenzoyl]phenyl]-[3-[(E)-hydroxyiminomethyl]-2,4-dimethoxyphenyl]methanone.
| Compound Name | [3-[3-[(E)-hydroxyiminomethyl]-2,4-dimethoxybenzoyl]phenyl]-[3-[(E)-hydroxyiminomethyl]-2,4-dimethoxyphenyl]methanone |
|---|---|
| PubChem CID | 88904908 |
| Molecular Formula | C26H24N2O8 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [3-[3-[(E)-hydroxyiminomethyl]-2,4-dimethoxybenzoyl]phenyl]-[3-[(E)-hydroxyiminomethyl]-2,4-dimethoxyphenyl]methanone |
| SMILES | COc1ccc(C(=O)c2cccc(C(=O)c3ccc(OC)c(/C=N/O)c3OC)c2)c(OC)c1/C=N/O |
| InChI | InChI=1S/C26H24N2O8/c1-33-21-10-8-17(25(35-3)19(21)13-27-31)23(29)15-6-5-7-16(12-15)24(30)18-9-11-22(34-2)20(14-28-32)26(18)36-4/h5-14,31-32H,1-4H3/b27-13+,28-14+ |
| InChIKey | DLZSXQCXPVLUQS-OCHFTUDZSA-N |
| XLogP | 3.80 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|