C40H29N3O7S — CID 88904964
2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl N-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]carbamate (PubChem CID 88904964) has the molecular formula C40H29N3O7S and a molecular weight of 695.75 g/mol. Its IUPAC name is 2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl N-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]carbamate.
| Compound Name | 2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl N-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 88904964 |
| Molecular Formula | C40H29N3O7S |
| Molecular Weight | 695.75 g/mol |
| Exact Mass | 695.17 |
| IUPAC Name | 2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-ynyl N-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]carbamate |
| SMILES | O=C(NCCNC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21)OC1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C40H29N3O7S/c44-27-12-15-32-35(21-27)48-36-22-28(45)13-16-33(36)40(32)31-14-11-26(20-30(31)37(46)50-40)43-38(51)41-17-18-42-39(47)49-34-19-25-7-2-1-5-23(25)9-10-24-6-3-4-8-29(24)34/h1-8,11-16,20-22,34,44-45H,17-19H2,(H,42,47)(H2,41,43,51) |
| InChIKey | KXTWQCCPUAEZJU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 138.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.75 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|