About 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate
3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate (PubChem CID 88905095) has the molecular formula C16H34O2Si
and a molecular weight of 286.53 g/mol. Its IUPAC name is 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate |
| PubChem CID | 88905095 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate |
| SMILES | CCC(C)(CC(C)(C)C)C(=O)OCCC[Si](C)(C)C |
| InChI | InChI=1S/C16H34O2Si/c1-9-16(5,13-15(2,3)4)14(17)18-11-10-12-19(6,7)8/h9-13H2,1-8H3 |
| InChIKey | NQORQYLEESTCNZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate?
The IUPAC name of 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate (CID 88905095) is 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate.
What is the SMILES notation for 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate?
The canonical SMILES for 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate is CCC(C)(CC(C)(C)C)C(=O)OCCC[Si](C)(C)C.
What is the InChIKey of 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate?
The InChIKey is NQORQYLEESTCNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O2Si/c1-9-16(5,13-15(2,3)4)14(17)18-11-10-12-19(6,7)8/h9-13H2,1-8H3.
What are the key properties of 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate?
3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate has a molecular weight of 286.53 g/mol, XLogP of 5.11, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethylsilylpropyl 2-ethyl-2,4,4-trimethylpentanoate is sourced from PubChem (CID 88905095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).