C13H22N2 — CID 88905163
(2E,4Z)-4-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-amine (PubChem CID 88905163) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (2E,4Z)-4-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-4-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 88905163 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (2E,4Z)-4-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(CN1CCCCC1)\C(N)=C/C |
| InChI | InChI=1S/C13H22N2/c1-3-8-12(13(14)4-2)11-15-9-6-5-7-10-15/h3-4,8H,1,5-7,9-11,14H2,2H3/b12-8-,13-4+ |
| InChIKey | VLBKYCVUZQJJER-ZGTLABSISA-N |
| XLogP | 2.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|