C13H22N2O — CID 88905168
(2E,4Z)-4-[(3-methoxypyrrolidin-1-yl)methyl]hepta-2,4,6-trien-3-amine (PubChem CID 88905168) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (2E,4Z)-4-[(3-methoxypyrrolidin-1-yl)methyl]hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-4-[(3-methoxypyrrolidin-1-yl)methyl]hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 88905168 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (2E,4Z)-4-[(3-methoxypyrrolidin-1-yl)methyl]hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(CN1CCC(OC)C1)\C(N)=C/C |
| InChI | InChI=1S/C13H22N2O/c1-4-6-11(13(14)5-2)9-15-8-7-12(10-15)16-3/h4-6,12H,1,7-10,14H2,2-3H3/b11-6-,13-5+ |
| InChIKey | HUKIFRARWABUPX-ZHXKYXHWSA-N |
| XLogP | 1.68 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|