About 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine
4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine (PubChem CID 88905177) has the molecular formula C19H21ClN2O
and a molecular weight of 328.84 g/mol. Its IUPAC name is 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine |
| PubChem CID | 88905177 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine |
| SMILES | C=C/C=c1/c(N2CCOCC2)cn(-c2ccc(Cl)cc2)/c1=C/C |
| InChI | InChI=1S/C19H21ClN2O/c1-3-5-17-18(4-2)22(16-8-6-15(20)7-9-16)14-19(17)21-10-12-23-13-11-21/h3-9,14H,1,10-13H2,2H3/b17-5+,18-4+ |
| InChIKey | HXNZNUVMIHKTQQ-RNYCDPPRSA-N |
| XLogP | 2.73 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine?
The IUPAC name of 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine (CID 88905177) is 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine.
What is the SMILES notation for 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine?
The canonical SMILES for 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine is C=C/C=c1/c(N2CCOCC2)cn(-c2ccc(Cl)cc2)/c1=C/C.
What is the InChIKey of 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine?
The InChIKey is HXNZNUVMIHKTQQ-RNYCDPPRSA-N. The full InChI is InChI=1S/C19H21ClN2O/c1-3-5-17-18(4-2)22(16-8-6-15(20)7-9-16)14-19(17)21-10-12-23-13-11-21/h3-9,14H,1,10-13H2,2H3/b17-5+,18-4+.
What are the key properties of 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine?
4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine has a molecular weight of 328.84 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4E,5E)-1-(4-chlorophenyl)-5-ethylidene-4-prop-2-enylidenepyrrol-3-yl]morpholine is sourced from PubChem (CID 88905177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).