C14H24N2O — CID 88905269
(2E,4Z)-4-[(3,3-dimethylmorpholin-4-yl)methyl]hepta-2,4,6-trien-3-amine (PubChem CID 88905269) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (2E,4Z)-4-[(3,3-dimethylmorpholin-4-yl)methyl]hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-4-[(3,3-dimethylmorpholin-4-yl)methyl]hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 88905269 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (2E,4Z)-4-[(3,3-dimethylmorpholin-4-yl)methyl]hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(CN1CCOCC1(C)C)\C(N)=C/C |
| InChI | InChI=1S/C14H24N2O/c1-5-7-12(13(15)6-2)10-16-8-9-17-11-14(16,3)4/h5-7H,1,8-11,15H2,2-4H3/b12-7-,13-6+ |
| InChIKey | URAQIZKYVMLWFF-UNUUJLFKSA-N |
| XLogP | 2.07 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|