About 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine
4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine (PubChem CID 88905284) has the molecular formula C14H21N3O
and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine |
| PubChem CID | 88905284 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine |
| SMILES | C=C/C=c1/c(N2CCOC(C)(C)C2)n[nH]/c1=C/C |
| InChI | InChI=1S/C14H21N3O/c1-5-7-11-12(6-2)15-16-13(11)17-8-9-18-14(3,4)10-17/h5-7,15H,1,8-10H2,2-4H3/b11-7+,12-6+ |
| InChIKey | CSQCJCRTDSQNCK-IAVOFVOCSA-N |
| XLogP | 0.79 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine?
The IUPAC name of 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine (CID 88905284) is 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine.
What is the SMILES notation for 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine?
The canonical SMILES for 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine is C=C/C=c1/c(N2CCOC(C)(C)C2)n[nH]/c1=C/C.
What is the InChIKey of 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine?
The InChIKey is CSQCJCRTDSQNCK-IAVOFVOCSA-N. The full InChI is InChI=1S/C14H21N3O/c1-5-7-11-12(6-2)15-16-13(11)17-8-9-18-14(3,4)10-17/h5-7,15H,1,8-10H2,2-4H3/b11-7+,12-6+.
What are the key properties of 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine?
4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine has a molecular weight of 247.34 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4E,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrazol-3-yl]-2,2-dimethylmorpholine is sourced from PubChem (CID 88905284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).