C8H9FO — CID 88905355
(4Z,6E)-7-fluoro-3-methylidenehepta-4,6-dienal (PubChem CID 88905355) has the molecular formula C8H9FO and a molecular weight of 140.16 g/mol. Its IUPAC name is (4Z,6E)-7-fluoro-3-methylidenehepta-4,6-dienal.
| Compound Name | (4Z,6E)-7-fluoro-3-methylidenehepta-4,6-dienal |
|---|---|
| PubChem CID | 88905355 |
| Molecular Formula | C8H9FO |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | (4Z,6E)-7-fluoro-3-methylidenehepta-4,6-dienal |
| SMILES | C=C(/C=C\C=C\F)CC=O |
| InChI | InChI=1S/C8H9FO/c1-8(5-7-10)4-2-3-6-9/h2-4,6-7H,1,5H2/b4-2-,6-3+ |
| InChIKey | YLQREZNRYOZPOG-MDNDHVJUSA-N |
| XLogP | 2.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|