C8H15N3 — CID 88905577
2-N-methyl-2-N-(3-methylbuta-1,3-dien-2-yl)ethene-1,1,2-triamine (PubChem CID 88905577) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-N-methyl-2-N-(3-methylbuta-1,3-dien-2-yl)ethene-1,1,2-triamine.
| Compound Name | 2-N-methyl-2-N-(3-methylbuta-1,3-dien-2-yl)ethene-1,1,2-triamine |
|---|---|
| PubChem CID | 88905577 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 2-N-methyl-2-N-(3-methylbuta-1,3-dien-2-yl)ethene-1,1,2-triamine |
| SMILES | C=C(C)C(=C)N(C)C=C(N)N |
| InChI | InChI=1S/C8H15N3/c1-6(2)7(3)11(4)5-8(9)10/h5H,1,3,9-10H2,2,4H3 |
| InChIKey | ROGQINQGVICAEG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|