About 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine
2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine (PubChem CID 88905588) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 88905588 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine |
| SMILES | [H]/N=C/C1=CC=CCC1NC |
| InChI | InChI=1S/C8H12N2/c1-10-8-5-3-2-4-7(8)6-9/h2-4,6,8-10H,5H2,1H3/b9-6+ |
| InChIKey | QIVHYHOHYMIZAK-RMKNXTFCSA-N |
| XLogP | 1.11 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine (CID 88905588) is 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine is [H]/N=C/C1=CC=CCC1NC.
What is the InChIKey of 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine?
The InChIKey is QIVHYHOHYMIZAK-RMKNXTFCSA-N. The full InChI is InChI=1S/C8H12N2/c1-10-8-5-3-2-4-7(8)6-9/h2-4,6,8-10H,5H2,1H3/b9-6+.
What are the key properties of 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine?
2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine has a molecular weight of 136.20 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanimidoyl-N-methylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 88905588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).