About (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol
(2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol (PubChem CID 88905625) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol.
Molecular Properties
| Compound Name | (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol |
| PubChem CID | 88905625 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol |
| SMILES | C=C/C(=C\C[C@@H](O)CN)CC |
| InChI | InChI=1S/C9H17NO/c1-3-8(4-2)5-6-9(11)7-10/h3,5,9,11H,1,4,6-7,10H2,2H3/b8-5+/t9-/m1/s1 |
| InChIKey | VXUSCDBFGURZGQ-WHXYTISESA-N |
| XLogP | 1.22 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol?
The IUPAC name of (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol (CID 88905625) is (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol.
What is the SMILES notation for (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol?
The canonical SMILES for (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol is C=C/C(=C\C[C@@H](O)CN)CC.
What is the InChIKey of (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol?
The InChIKey is VXUSCDBFGURZGQ-WHXYTISESA-N. The full InChI is InChI=1S/C9H17NO/c1-3-8(4-2)5-6-9(11)7-10/h3,5,9,11H,1,4,6-7,10H2,2H3/b8-5+/t9-/m1/s1.
What are the key properties of (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol?
(2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol has a molecular weight of 155.24 g/mol, XLogP of 1.22, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4Z)-1-amino-5-ethylhepta-4,6-dien-2-ol is sourced from PubChem (CID 88905625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).