C26H21N7O8 — CID 88905867
2-[2-[2-[(E)-3-[2-[2-[2-(1-amino-2-methylpropyl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-3-hydroxyprop-1-enyl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazole-4-carbaldehyde (PubChem CID 88905867) has the molecular formula C26H21N7O8 and a molecular weight of 559.50 g/mol. Its IUPAC name is 2-[2-[2-[(E)-3-[2-[2-[2-(1-amino-2-methylpropyl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-3-hydroxyprop-1-enyl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazole-4-carbaldehyde.
| Compound Name | 2-[2-[2-[(E)-3-[2-[2-[2-(1-amino-2-methylpropyl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-3-hydroxyprop-1-enyl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 88905867 |
| Molecular Formula | C26H21N7O8 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 2-[2-[2-[(E)-3-[2-[2-[2-(1-amino-2-methylpropyl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-3-hydroxyprop-1-enyl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazole-4-carbaldehyde |
| SMILES | CC(C)C(N)c1nc(-c2nc(-c3nc(C(O)/C=C/c4nc(-c5nc(-c6nc(C=O)co6)co5)co4)co3)co2)co1 |
| InChI | InChI=1S/C26H21N7O8/c1-12(2)21(27)26-33-18(11-41-26)25-32-17(10-40-25)24-30-14(7-38-24)19(35)3-4-20-29-15(8-36-20)23-31-16(9-39-23)22-28-13(5-34)6-37-22/h3-12,19,21,35H,27H2,1-2H3/b4-3+ |
| InChIKey | HHLKYJSXOYGHPR-ONEGZZNKSA-N |
| XLogP | 4.50 |
| TPSA | 219.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|