C19H27N9O2 — CID 88906074
(2S)-2-[[2-[[(2Z)-2-(aminohydrazinylidene)-2-(methylideneamino)ethyl]-benzylamino]acetyl]amino]-3-(1H-imidazol-5-yl)-N-methylpropanamide (PubChem CID 88906074) has the molecular formula C19H27N9O2 and a molecular weight of 413.49 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2Z)-2-(aminohydrazinylidene)-2-(methylideneamino)ethyl]-benzylamino]acetyl]amino]-3-(1H-imidazol-5-yl)-N-methylpropanamide.
| Compound Name | (2S)-2-[[2-[[(2Z)-2-(aminohydrazinylidene)-2-(methylideneamino)ethyl]-benzylamino]acetyl]amino]-3-(1H-imidazol-5-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 88906074 |
| Molecular Formula | C19H27N9O2 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | (2S)-2-[[2-[[(2Z)-2-(aminohydrazinylidene)-2-(methylideneamino)ethyl]-benzylamino]acetyl]amino]-3-(1H-imidazol-5-yl)-N-methylpropanamide |
| SMILES | C=N/C(CN(CC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)NC)Cc1ccccc1)=N\NN |
| InChI | InChI=1S/C19H27N9O2/c1-21-17(26-27-20)11-28(10-14-6-4-3-5-7-14)12-18(29)25-16(19(30)22-2)8-15-9-23-13-24-15/h3-7,9,13,16,27H,1,8,10-12,20H2,2H3,(H,22,30)(H,23,24)(H,25,29)/b26-17-/t16-/m0/s1 |
| InChIKey | HNHWJUBAOUTCOR-CVNUAIRLSA-N |
| XLogP | -0.84 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|