C41H50N4 — CID 88906596
4-[(2E)-5,5-bis[4-(diethylamino)phenyl]-1-(4-iminocyclohexa-2,5-dien-1-ylidene)penta-2,4-dienyl]-N,N-diethylaniline (PubChem CID 88906596) has the molecular formula C41H50N4 and a molecular weight of 598.88 g/mol. Its IUPAC name is 4-[(2E)-5,5-bis[4-(diethylamino)phenyl]-1-(4-iminocyclohexa-2,5-dien-1-ylidene)penta-2,4-dienyl]-N,N-diethylaniline.
| Compound Name | 4-[(2E)-5,5-bis[4-(diethylamino)phenyl]-1-(4-iminocyclohexa-2,5-dien-1-ylidene)penta-2,4-dienyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 88906596 |
| Molecular Formula | C41H50N4 |
| Molecular Weight | 598.88 g/mol |
| Exact Mass | 598.40 |
| IUPAC Name | 4-[(2E)-5,5-bis[4-(diethylamino)phenyl]-1-(4-iminocyclohexa-2,5-dien-1-ylidene)penta-2,4-dienyl]-N,N-diethylaniline |
| SMILES | [H]N=C1C=CC(=C(/C=C/C=C(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)C=C1 |
| InChI | InChI=1S/C41H50N4/c1-7-43(8-2)37-26-18-33(19-27-37)40(32-16-24-36(42)25-17-32)14-13-15-41(34-20-28-38(29-21-34)44(9-3)10-4)35-22-30-39(31-23-35)45(11-5)12-6/h13-31,42H,7-12H2,1-6H3/b14-13+,40-32-,42-36+ |
| InChIKey | ZLRKJMYKWRXQFA-UDNIWLLQSA-N |
| XLogP | 9.81 |
| TPSA | 33.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.88 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|