About N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine
N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine (PubChem CID 88906609) has the molecular formula C13H23ClN4O
and a molecular weight of 286.81 g/mol. Its IUPAC name is N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine |
| PubChem CID | 88906609 |
| Molecular Formula | C13H23ClN4O |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine |
| SMILES | COCCN(C)CCCNc1nc(Cl)nc(C)c1C |
| InChI | InChI=1S/C13H23ClN4O/c1-10-11(2)16-13(14)17-12(10)15-6-5-7-18(3)8-9-19-4/h5-9H2,1-4H3,(H,15,16,17) |
| InChIKey | BWQUFAZIYNECOF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine?
The IUPAC name of N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine (CID 88906609) is N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine?
The canonical SMILES for N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine is COCCN(C)CCCNc1nc(Cl)nc(C)c1C.
What is the InChIKey of N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine?
The InChIKey is BWQUFAZIYNECOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23ClN4O/c1-10-11(2)16-13(14)17-12(10)15-6-5-7-18(3)8-9-19-4/h5-9H2,1-4H3,(H,15,16,17).
What are the key properties of N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine?
N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine has a molecular weight of 286.81 g/mol, XLogP of 2.13, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-5,6-dimethylpyrimidin-4-yl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 88906609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).