C15H21NO5 — CID 88906745
[(3aR,7aS)-4,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl] tert-butyl carbonate (PubChem CID 88906745) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is [(3aR,7aS)-4,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl] tert-butyl carbonate.
| Compound Name | [(3aR,7aS)-4,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 88906745 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [(3aR,7aS)-4,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl] tert-butyl carbonate |
| SMILES | CC1C=CC(C)[C@@H]2C(=O)N(OC(=O)OC(C)(C)C)C(=O)[C@H]12 |
| InChI | InChI=1S/C15H21NO5/c1-8-6-7-9(2)11-10(8)12(17)16(13(11)18)21-14(19)20-15(3,4)5/h6-11H,1-5H3/t8?,9?,10-,11+ |
| InChIKey | LFHGMGCETDYTCY-HWACXVBKSA-N |
| XLogP | 2.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|