C45H41N3O2 — CID 88907076
(2E,4E,6E)-7-[1-(4-butan-2-ylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-2-cyano-7-[4-(N-phenylanilino)phenyl]hepta-2,4,6-trienoic acid (PubChem CID 88907076) has the molecular formula C45H41N3O2 and a molecular weight of 655.84 g/mol. Its IUPAC name is (2E,4E,6E)-7-[1-(4-butan-2-ylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-2-cyano-7-[4-(N-phenylanilino)phenyl]hepta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-7-[1-(4-butan-2-ylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-2-cyano-7-[4-(N-phenylanilino)phenyl]hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 88907076 |
| Molecular Formula | C45H41N3O2 |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.32 |
| IUPAC Name | (2E,4E,6E)-7-[1-(4-butan-2-ylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-2-cyano-7-[4-(N-phenylanilino)phenyl]hepta-2,4,6-trienoic acid |
| SMILES | CCC(C)c1ccc(N2CCCc3cc(/C(=C/C=C/C=C(\C#N)C(=O)O)c4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc32)cc1 |
| InChI | InChI=1S/C45H41N3O2/c1-3-33(2)34-20-25-39(26-21-34)47-30-12-14-37-31-36(24-29-44(37)47)43(19-11-10-13-38(32-46)45(49)50)35-22-27-42(28-23-35)48(40-15-6-4-7-16-40)41-17-8-5-9-18-41/h4-11,13,15-29,31,33H,3,12,14,30H2,1-2H3,(H,49,50)/b11-10+,38-13+,43-19+ |
| InChIKey | YGPMKPNCSUFYCY-IZIBQKEYSA-N |
| XLogP | 11.28 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|