C29H30N4O7S2 — CID 88907109
5-[(2E)-5,5-bis[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]penta-2,4-dienylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 88907109) has the molecular formula C29H30N4O7S2 and a molecular weight of 610.71 g/mol. Its IUPAC name is 5-[(2E)-5,5-bis[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]penta-2,4-dienylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2E)-5,5-bis[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]penta-2,4-dienylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 88907109 |
| Molecular Formula | C29H30N4O7S2 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | 5-[(2E)-5,5-bis[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]penta-2,4-dienylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=C/C=C/C=C(c2ccc(N3CCS(=O)(=O)CC3)cc2)c2ccc(N3CCS(=O)(=O)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C29H30N4O7S2/c34-27-26(28(35)31-29(36)30-27)4-2-1-3-25(21-5-9-23(10-6-21)32-13-17-41(37,38)18-14-32)22-7-11-24(12-8-22)33-15-19-42(39,40)20-16-33/h1-12H,13-20H2,(H2,30,31,34,35,36)/b2-1+ |
| InChIKey | SJTURSAYUFLNAE-OWOJBTEDSA-N |
| XLogP | 1.44 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|