C27H32N2O3 — CID 88907169
2-[3-[2-[[(2R)-2-(3-amino-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]acetaldehyde (PubChem CID 88907169) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is 2-[3-[2-[[(2R)-2-(3-amino-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]acetaldehyde.
| Compound Name | 2-[3-[2-[[(2R)-2-(3-amino-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 88907169 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 2-[3-[2-[[(2R)-2-(3-amino-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]-2-methylpropyl]phenyl]acetaldehyde |
| SMILES | CC(C)(Cc1cccc(CC=O)c1)NC[C@H](O)c1ccc(OCc2ccccc2)c(N)c1 |
| InChI | InChI=1S/C27H32N2O3/c1-27(2,17-22-10-6-9-20(15-22)13-14-30)29-18-25(31)23-11-12-26(24(28)16-23)32-19-21-7-4-3-5-8-21/h3-12,14-16,25,29,31H,13,17-19,28H2,1-2H3/t25-/m0/s1 |
| InChIKey | BCMUMQFFPJWETB-VWLOTQADSA-N |
| XLogP | 4.23 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|