About 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine
1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine (PubChem CID 88907206) has the molecular formula C14H19N4+
and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine.
Molecular Properties
| Compound Name | 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine |
| PubChem CID | 88907206 |
| Molecular Formula | C14H19N4+ |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine |
| SMILES | C[n+]1ccn(CCN2CCc3ccc(N)cc32)c1 |
| InChI | InChI=1S/C14H19N4/c1-16-6-7-17(11-16)8-9-18-5-4-12-2-3-13(15)10-14(12)18/h2-3,6-7,10-11H,4-5,8-9,15H2,1H3/q+1 |
| InChIKey | UBZMAOWGWOJXEP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine?
The IUPAC name of 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine (CID 88907206) is 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine.
What is the SMILES notation for 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine?
The canonical SMILES for 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine is C[n+]1ccn(CCN2CCc3ccc(N)cc32)c1.
What is the InChIKey of 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine?
The InChIKey is UBZMAOWGWOJXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N4/c1-16-6-7-17(11-16)8-9-18-5-4-12-2-3-13(15)10-14(12)18/h2-3,6-7,10-11H,4-5,8-9,15H2,1H3/q+1.
What are the key properties of 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine?
1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine has a molecular weight of 243.33 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-methylimidazol-3-ium-1-yl)ethyl]-2,3-dihydroindol-6-amine is sourced from PubChem (CID 88907206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).