About methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate
methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 88907233) has the molecular formula C15H19ClF3N3O2
and a molecular weight of 365.78 g/mol. Its IUPAC name is methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate |
| PubChem CID | 88907233 |
| Molecular Formula | C15H19ClF3N3O2 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | CC[C@H]1CN(c2ccc(C(=O)OC)nc2C(F)(F)F)[C@H](C)CN1Cl |
| InChI | InChI=1S/C15H19ClF3N3O2/c1-4-10-8-21(9(2)7-22(10)16)12-6-5-11(14(23)24-3)20-13(12)15(17,18)19/h5-6,9-10H,4,7-8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | FZMIZZTTYRAVKT-ZJUUUORDSA-N |
| XLogP | 3.33 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate?
The IUPAC name of methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate (CID 88907233) is methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate?
The canonical SMILES for methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate is CC[C@H]1CN(c2ccc(C(=O)OC)nc2C(F)(F)F)[C@H](C)CN1Cl.
What is the InChIKey of methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate?
The InChIKey is FZMIZZTTYRAVKT-ZJUUUORDSA-N. The full InChI is InChI=1S/C15H19ClF3N3O2/c1-4-10-8-21(9(2)7-22(10)16)12-6-5-11(14(23)24-3)20-13(12)15(17,18)19/h5-6,9-10H,4,7-8H2,1-3H3/t9-,10+/m1/s1.
What are the key properties of methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate?
methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate has a molecular weight of 365.78 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2R,5S)-4-chloro-5-ethyl-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyridine-2-carboxylate is sourced from PubChem (CID 88907233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).