C20H35NO5 — CID 88907297
(1S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 88907297) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is (1S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 88907297 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | (1S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C[C@H]1CCC[C@@]2(C)O[C@H]2CCNC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C20H35NO5/c1-12-7-6-9-20(5)15(26-20)8-10-21-16(23)11-14(22)19(3,4)18(25)13(2)17(12)24/h12-15,17,22,24H,6-11H2,1-5H3,(H,21,23)/t12-,13+,14-,15-,17-,20+/m0/s1 |
| InChIKey | CUXZYTUZGGIPPP-KJMAVMMSSA-N |
| XLogP | 1.81 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|