About 7,15-dioxatricyclo[12.1.0.06,8]pentadecane
7,15-dioxatricyclo[12.1.0.06,8]pentadecane (PubChem CID 88907444) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 7,15-dioxatricyclo[12.1.0.06,8]pentadecane.
Molecular Properties
| Compound Name | 7,15-dioxatricyclo[12.1.0.06,8]pentadecane |
| PubChem CID | 88907444 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 7,15-dioxatricyclo[12.1.0.06,8]pentadecane |
| SMILES | C1CCC2OC2CCCCC2OC2CC1 |
| InChI | InChI=1S/C13H22O2/c1-2-6-10-12(14-10)8-4-5-9-13-11(15-13)7-3-1/h10-13H,1-9H2 |
| InChIKey | QFQOBXXZCDQMDI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7,15-dioxatricyclo[12.1.0.06,8]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,15-dioxatricyclo[12.1.0.06,8]pentadecane?
The IUPAC name of 7,15-dioxatricyclo[12.1.0.06,8]pentadecane (CID 88907444) is 7,15-dioxatricyclo[12.1.0.06,8]pentadecane.
What is the SMILES notation for 7,15-dioxatricyclo[12.1.0.06,8]pentadecane?
The canonical SMILES for 7,15-dioxatricyclo[12.1.0.06,8]pentadecane is C1CCC2OC2CCCCC2OC2CC1.
What is the InChIKey of 7,15-dioxatricyclo[12.1.0.06,8]pentadecane?
The InChIKey is QFQOBXXZCDQMDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-2-6-10-12(14-10)8-4-5-9-13-11(15-13)7-3-1/h10-13H,1-9H2.
What are the key properties of 7,15-dioxatricyclo[12.1.0.06,8]pentadecane?
7,15-dioxatricyclo[12.1.0.06,8]pentadecane has a molecular weight of 210.32 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,15-dioxatricyclo[12.1.0.06,8]pentadecane is sourced from PubChem (CID 88907444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).