C24H34O — CID 88907460
3-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)propanal (PubChem CID 88907460) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is 3-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)propanal.
| Compound Name | 3-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)propanal |
|---|---|
| PubChem CID | 88907460 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 3-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)propanal |
| SMILES | CC(C)(C)C1=CC2C(C=C1)C1C=CC(C(C)(C)C)=CC1C2CCC=O |
| InChI | InChI=1S/C24H34O/c1-23(2,3)16-9-11-19-20-12-10-17(24(4,5)6)15-22(20)18(8-7-13-25)21(19)14-16/h9-15,18-22H,7-8H2,1-6H3 |
| InChIKey | KWJVBUFJPFKGNC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|