C12H15F11O — CID 88907472
2-[difluoro-(3,4,4,4-tetrafluoro-3-methylbutan-2-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane (PubChem CID 88907472) has the molecular formula C12H15F11O and a molecular weight of 384.23 g/mol. Its IUPAC name is 2-[difluoro-(3,4,4,4-tetrafluoro-3-methylbutan-2-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane.
| Compound Name | 2-[difluoro-(3,4,4,4-tetrafluoro-3-methylbutan-2-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane |
|---|---|
| PubChem CID | 88907472 |
| Molecular Formula | C12H15F11O |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-[difluoro-(3,4,4,4-tetrafluoro-3-methylbutan-2-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane |
| SMILES | CCC(C)(F)C(F)(C(F)(F)F)C(F)(F)OC(C)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F11O/c1-5-7(3,13)9(15,11(19,20)21)12(22,23)24-6(2)8(4,14)10(16,17)18/h6H,5H2,1-4H3 |
| InChIKey | RJHQVHICISNYHH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |