C13H18F10O2 — CID 88907626
2-[difluoro-(3,4,4,4-tetrafluoro-3-methylbutan-2-yl)oxymethyl]-1,1,1,2-tetrafluoro-3-methoxy-3-methylpentane (PubChem CID 88907626) has the molecular formula C13H18F10O2 and a molecular weight of 396.27 g/mol. Its IUPAC name is 2-[difluoro-(3,4,4,4-tetrafluoro-3-methylbutan-2-yl)oxymethyl]-1,1,1,2-tetrafluoro-3-methoxy-3-methylpentane.
| Compound Name | 2-[difluoro-(3,4,4,4-tetrafluoro-3-methylbutan-2-yl)oxymethyl]-1,1,1,2-tetrafluoro-3-methoxy-3-methylpentane |
|---|---|
| PubChem CID | 88907626 |
| Molecular Formula | C13H18F10O2 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-[difluoro-(3,4,4,4-tetrafluoro-3-methylbutan-2-yl)oxymethyl]-1,1,1,2-tetrafluoro-3-methoxy-3-methylpentane |
| SMILES | CCC(C)(OC)C(F)(C(F)(F)F)C(F)(F)OC(C)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C13H18F10O2/c1-6-8(3,24-5)10(15,12(19,20)21)13(22,23)25-7(2)9(4,14)11(16,17)18/h7H,6H2,1-5H3 |
| InChIKey | VFRHNJCAGBANRW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |