C20H33N5 — CID 88907733
(Z)-N-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-piperazin-1-yl-4H-pyrimidin-3-yl]ethanimine (PubChem CID 88907733) has the molecular formula C20H33N5 and a molecular weight of 343.52 g/mol. Its IUPAC name is (Z)-N-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-piperazin-1-yl-4H-pyrimidin-3-yl]ethanimine.
| Compound Name | (Z)-N-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-piperazin-1-yl-4H-pyrimidin-3-yl]ethanimine |
|---|---|
| PubChem CID | 88907733 |
| Molecular Formula | C20H33N5 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | (Z)-N-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-piperazin-1-yl-4H-pyrimidin-3-yl]ethanimine |
| SMILES | C/C=N\N1C(N2CCNCC2)=NC=C(/C(C)=C/C=C\[C@H](C)CC)C1C |
| InChI | InChI=1S/C20H33N5/c1-6-16(3)9-8-10-17(4)19-15-22-20(24-13-11-21-12-14-24)25(18(19)5)23-7-2/h7-10,15-16,18,21H,6,11-14H2,1-5H3/b9-8-,17-10+,23-7-/t16-,18?/m1/s1 |
| InChIKey | YBHBSUJUJALCQM-JLTHCUGCSA-N |
| XLogP | 3.39 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|