C13H17F11O — CID 88907758
2-[difluoro-(1,1,1,2-tetrafluoro-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane (PubChem CID 88907758) has the molecular formula C13H17F11O and a molecular weight of 398.26 g/mol. Its IUPAC name is 2-[difluoro-(1,1,1,2-tetrafluoro-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane.
| Compound Name | 2-[difluoro-(1,1,1,2-tetrafluoro-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane |
|---|---|
| PubChem CID | 88907758 |
| Molecular Formula | C13H17F11O |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-[difluoro-(1,1,1,2-tetrafluoro-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane |
| SMILES | CCC(C)(OC(F)(F)C(F)(C(F)(F)F)C(C)(F)CC)C(F)C(F)(F)F |
| InChI | InChI=1S/C13H17F11O/c1-5-8(3,7(14)10(16,17)18)25-13(23,24)11(19,12(20,21)22)9(4,15)6-2/h7H,5-6H2,1-4H3 |
| InChIKey | QADCKPFCRBOQIM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |