C21H35N5 — CID 88907872
(Z)-N-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-(4-methylpiperazin-1-yl)-4H-pyrimidin-3-yl]ethanimine (PubChem CID 88907872) has the molecular formula C21H35N5 and a molecular weight of 357.55 g/mol. Its IUPAC name is (Z)-N-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-(4-methylpiperazin-1-yl)-4H-pyrimidin-3-yl]ethanimine.
| Compound Name | (Z)-N-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-(4-methylpiperazin-1-yl)-4H-pyrimidin-3-yl]ethanimine |
|---|---|
| PubChem CID | 88907872 |
| Molecular Formula | C21H35N5 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | (Z)-N-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-(4-methylpiperazin-1-yl)-4H-pyrimidin-3-yl]ethanimine |
| SMILES | C/C=N\N1C(N2CCN(C)CC2)=NC=C(/C(C)=C/C=C\[C@H](C)CC)C1C |
| InChI | InChI=1S/C21H35N5/c1-7-17(3)10-9-11-18(4)20-16-22-21(26(19(20)5)23-8-2)25-14-12-24(6)13-15-25/h8-11,16-17,19H,7,12-15H2,1-6H3/b10-9-,18-11+,23-8-/t17-,19?/m1/s1 |
| InChIKey | MOOHKLPUKKYPJP-RHJUKTDNSA-N |
| XLogP | 3.73 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|