C30H22N2O11S2 — CID 88908402
[2-methoxy-5-[13-(3-methoxysulfonyl-4-methylphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]phenyl]methanesulfonic acid (PubChem CID 88908402) has the molecular formula C30H22N2O11S2 and a molecular weight of 650.64 g/mol. Its IUPAC name is [2-methoxy-5-[13-(3-methoxysulfonyl-4-methylphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]phenyl]methanesulfonic acid.
| Compound Name | [2-methoxy-5-[13-(3-methoxysulfonyl-4-methylphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 88908402 |
| Molecular Formula | C30H22N2O11S2 |
| Molecular Weight | 650.64 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | [2-methoxy-5-[13-(3-methoxysulfonyl-4-methylphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]phenyl]methanesulfonic acid |
| SMILES | COc1ccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2ccc(C)c(S(=O)(=O)OC)c2)C4=O)cc1CS(=O)(=O)O |
| InChI | InChI=1S/C30H22N2O11S2/c1-15-4-5-18(13-24(15)45(40,41)43-3)32-29(35)21-9-7-19-25-20(8-10-22(26(21)25)30(32)36)28(34)31(27(19)33)17-6-11-23(42-2)16(12-17)14-44(37,38)39/h4-13H,14H2,1-3H3,(H,37,38,39) |
| InChIKey | BTJIRMZTEFLXAZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 181.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|