About 8-methyltetradecan-7-ol
8-methyltetradecan-7-ol (PubChem CID 88908615) has the molecular formula C15H32O
and a molecular weight of 228.42 g/mol. Its IUPAC name is 8-methyltetradecan-7-ol.
Molecular Properties
| Compound Name | 8-methyltetradecan-7-ol |
| PubChem CID | 88908615 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | 8-methyltetradecan-7-ol |
| SMILES | CCCCCCC(C)C(O)CCCCCC |
| InChI | InChI=1S/C15H32O/c1-4-6-8-10-12-14(3)15(16)13-11-9-7-5-2/h14-16H,4-13H2,1-3H3 |
| InChIKey | VDMXBPKMIQJOMS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-methyltetradecan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyltetradecan-7-ol?
The IUPAC name of 8-methyltetradecan-7-ol (CID 88908615) is 8-methyltetradecan-7-ol.
What is the SMILES notation for 8-methyltetradecan-7-ol?
The canonical SMILES for 8-methyltetradecan-7-ol is CCCCCCC(C)C(O)CCCCCC.
What is the InChIKey of 8-methyltetradecan-7-ol?
The InChIKey is VDMXBPKMIQJOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O/c1-4-6-8-10-12-14(3)15(16)13-11-9-7-5-2/h14-16H,4-13H2,1-3H3.
What are the key properties of 8-methyltetradecan-7-ol?
8-methyltetradecan-7-ol has a molecular weight of 228.42 g/mol, XLogP of 4.92, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyltetradecan-7-ol is sourced from PubChem (CID 88908615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).